What is the chemical formula of Fmoc-abu-oh?
The chemical formula of Fmoc-abu-oh is C19H19NO4.
What is the molecular weight of Fmoc-abu-oh?
The molecular weight of Fmoc-abu-oh is 325.4 g/mol.
What is the IUPAC name of Fmoc-abu-oh?
The IUPAC name of Fmoc-abu-oh is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
What is the InChI of Fmoc-abu-oh?
The InChI of Fmoc-abu-oh is InChI=1S/C19H19NO4/c1-2-17(18(21)22)20-19(23)24-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16-17H,2,11H2,1H3,(H,20,23)(H,21,22)/t17-/m0/s1.
What is the InChIKey of Fmoc-abu-oh?
The InChIKey of Fmoc-abu-oh is XQIRYUNKLVPVRR-KRWDZBQOSA-N.
What is the canonical SMILES representation of Fmoc-abu-oh?
The canonical SMILES representation of Fmoc-abu-oh is CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13.
How many hydrogen bond donor atoms are present in Fmoc-abu-oh?
Fmoc-abu-oh has 2 hydrogen bond donor atoms.
How many hydrogen bond acceptor atoms are present in Fmoc-abu-oh?
Fmoc-abu-oh has 4 hydrogen bond acceptor atoms.
How many rotatable bonds are present in Fmoc-abu-oh?
Fmoc-abu-oh has 6 rotatable bonds.