What is the molecular formula of Fmoc-(4-aminophenyl)acetic acid?
The molecular formula of Fmoc-(4-aminophenyl)acetic acid is C23H19NO4.
What is the molecular weight of Fmoc-(4-aminophenyl)acetic acid?
The molecular weight of Fmoc-(4-aminophenyl)acetic acid is 373.4 g/mol.
What is the IUPAC name of Fmoc-(4-aminophenyl)acetic acid?
The IUPAC name of Fmoc-(4-aminophenyl)acetic acid is 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid.
What is the InChI of Fmoc-(4-aminophenyl)acetic acid?
The InChI of Fmoc-(4-aminophenyl)acetic acid is InChI=1S/C23H19NO4/c25-22(26)13-15-9-11-16(12-10-15)24-23(27)28-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21H,13-14H2,(H,24,27)(H,25,26).
What is the InChIKey of Fmoc-(4-aminophenyl)acetic acid?
The InChIKey of Fmoc-(4-aminophenyl)acetic acid is YRZJNRXNEUSRLW-UHFFFAOYSA-N.
What is the canonical SMILES of Fmoc-(4-aminophenyl)acetic acid?
The canonical SMILES of Fmoc-(4-aminophenyl)acetic acid is C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CC(=O)O.
What is the CAS number of Fmoc-(4-aminophenyl)acetic acid?
The CAS number of Fmoc-(4-aminophenyl)acetic acid is 173690-53-4.
What is the XLogP3-AA value of Fmoc-(4-aminophenyl)acetic acid?
The XLogP3-AA value of Fmoc-(4-aminophenyl)acetic acid is 4.1.
How many hydrogen bond donor counts are there in Fmoc-(4-aminophenyl)acetic acid?
There are 2 hydrogen bond donor counts in Fmoc-(4-aminophenyl)acetic acid.
How many hydrogen bond acceptor counts are there in Fmoc-(4-aminophenyl)acetic acid?
There are 4 hydrogen bond acceptor counts in Fmoc-(4-aminophenyl)acetic acid.
※ Please kindly note that our products are for research use only.