What is the molecular formula of Fmoc-4-aminocinnamic acid?
The molecular formula of Fmoc-4-aminocinnamic acid is C24H19NO4.
When was Fmoc-4-aminocinnamic acid created?
Fmoc-4-aminocinnamic acid was created on July 26, 2010.
What is the IUPAC name of Fmoc-4-aminocinnamic acid?
The IUPAC name of Fmoc-4-aminocinnamic acid is (E)-3-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]prop-2-enoic acid.
What is the InChI of Fmoc-4-aminocinnamic acid?
The InChI of Fmoc-4-aminocinnamic acid is InChI=1S/C24H19NO4/c26-23(27)14-11-16-9-12-17(13-10-16)25-24(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-14,22H,15H2,(H,25,28)(H,26,27)/b14-11+.
What is the molecular weight of Fmoc-4-aminocinnamic acid?
The molecular weight of Fmoc-4-aminocinnamic acid is 385.4 g/mol.
What is the XLogP3-AA value of Fmoc-4-aminocinnamic acid?
The XLogP3-AA value of Fmoc-4-aminocinnamic acid is 4.6.
How many hydrogen bond donor counts does Fmoc-4-aminocinnamic acid have?
Fmoc-4-aminocinnamic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Fmoc-4-aminocinnamic acid have?
Fmoc-4-aminocinnamic acid has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Fmoc-4-aminocinnamic acid have?
Fmoc-4-aminocinnamic acid has 6 rotatable bond counts.
What is the topological polar surface area of Fmoc-4-aminocinnamic acid?
The topological polar surface area of Fmoc-4-aminocinnamic acid is 75.6Ų.
※ Please kindly note that our products are for research use only.