What is the molecular formula of fluorescent yellow aa223?
The molecular formula of fluorescent yellow aa223 is C20H19N3O5S.
What is the molecular weight of fluorescent yellow aa223?
The molecular weight of fluorescent yellow aa223 is 413.4 g/mol.
What is the IUPAC Name of fluorescent yellow aa223?
The IUPAC Name of fluorescent yellow aa223 is 2-[7-(diethylamino)-2-oxochromen-3-yl]-1,3-benzoxazole-5-sulfonamide.
What is the InChIKey of fluorescent yellow aa223?
The InChIKey of fluorescent yellow aa223 is SDUIURJVOCHJCO-UHFFFAOYSA-N.
What is the Canonical SMILES of fluorescent yellow aa223?
The Canonical SMILES of fluorescent yellow aa223 is CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=NC4=C(O3)C=CC(=C4)S(=O)(=O)N.
What is the CAS number of fluorescent yellow aa223?
The CAS number of fluorescent yellow aa223 is 68427-35-0.
What is the European Community (EC) Number of fluorescent yellow aa223?
The European Community (EC) Number of fluorescent yellow aa223 is 270-393-3.
What is the UNII of fluorescent yellow aa223?
The UNII of fluorescent yellow aa223 is 05ZE90DQA4.
What is the XLogP3-AA value of fluorescent yellow aa223?
The XLogP3-AA value of fluorescent yellow aa223 is 2.8.
What is the hydrogen bond donor count of fluorescent yellow aa223?
The hydrogen bond donor count of fluorescent yellow aa223 is 1.