What is the molecular formula of Fluorescein O-methacrylate?
The molecular formula of Fluorescein O-methacrylate is C24H16O6.
What is the molecular weight of Fluorescein O-methacrylate?
The molecular weight of Fluorescein O-methacrylate is 400.4 g/mol.
What is the IUPAC name of Fluorescein O-methacrylate?
The IUPAC name of Fluorescein O-methacrylate is (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) 2-methylprop-2-enoate.
What is the InChI of Fluorescein O-methacrylate?
The InChI of Fluorescein O-methacrylate is InChI=1S/C24H16O6/c1-13(2)22(26)28-15-8-10-19-21(12-15)29-20-11-14(25)7-9-18(20)24(19)17-6-4-3-5-16(17)23(27)30-24/h3-12,25H,1H2,2H3.
What is the InChIKey of Fluorescein O-methacrylate?
The InChIKey of Fluorescein O-methacrylate is YMHPNLUYVDEYCI-UHFFFAOYSA-N.
What is the canonical SMILES of Fluorescein O-methacrylate?
The canonical SMILES of Fluorescein O-methacrylate is CC(=C)C(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)O)C5=CC=CC=C5C(=O)O3.
What is the CAS number of Fluorescein O-methacrylate?
The CAS number of Fluorescein O-methacrylate is 480439-15-4.
What is the European Community (EC) number of Fluorescein O-methacrylate?
The European Community (EC) number of Fluorescein O-methacrylate is 663-531-2.
What is the hydrogen bond donor count of Fluorescein O-methacrylate?
The hydrogen bond donor count of Fluorescein O-methacrylate is 1.
What is the hydrogen bond acceptor count of Fluorescein O-methacrylate?
The hydrogen bond acceptor count of Fluorescein O-methacrylate is 6.
※ Please kindly note that our products are for research use only.