What is the molecular formula of fast orange GR salt according to the reference?
The molecular formula of fast orange GR salt is C6H6N2O2.
What is the molecular weight of fast orange GR salt?
The molecular weight of fast orange GR salt is 138.12 g/mol.
What is the IUPAC name of fast orange GR salt?
The IUPAC name of fast orange GR salt is 2-nitroaniline.
What is the InChIKey of fast orange GR salt?
The InChIKey of fast orange GR salt is DPJCXCZTLWNFOH-UHFFFAOYSA-N.
What is the canonical SMILES of fast orange GR salt?
The canonical SMILES of fast orange GR salt is C1=CC=C(C(=C1)N)[N+](=O)[O-].
What is the CAS number of fast orange GR salt?
The CAS number of fast orange GR salt is 88-74-4.
What is the UNII of fast orange GR salt?
The UNII of fast orange GR salt is 2519U0541L.
What is the UN number of fast orange GR salt?
The UN number of fast orange GR salt is 1661.
What is the XLogP3 value of fast orange GR salt?
The XLogP3 value of fast orange GR salt is 1.9.
What is the topological polar surface area of fast orange GR salt?
The topological polar surface area of fast orange GR salt is 71.8 ?^2.