What is the molecular formula of Exo-2-aminonorbornane?
The molecular formula of Exo-2-aminonorbornane is C7H13N.
What is the molecular weight of Exo-2-aminonorbornane?
The molecular weight of Exo-2-aminonorbornane is 111.18 g/mol.
What is the IUPAC name of Exo-2-aminonorbornane?
The IUPAC name of Exo-2-aminonorbornane is (1R,2R,4S)-bicyclo[2.2.1]heptan-2-amine.
What is the CAS number of Exo-2-aminonorbornane?
The CAS number of Exo-2-aminonorbornane is 7242-92-4.
What is the InChI of Exo-2-aminonorbornane?
The InChI of Exo-2-aminonorbornane is InChI=1S/C7H13N/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4,8H2/t5-,6+,7+/m0/s1.
What is the InChIKey of Exo-2-aminonorbornane?
The InChIKey of Exo-2-aminonorbornane is JEPPYVOSGKWVSJ-RRKCRQDMSA-N.
What is the canonical SMILES of Exo-2-aminonorbornane?
The canonical SMILES of Exo-2-aminonorbornane is C1CC2CC1CC2N.
What is the isomeric SMILES of Exo-2-aminonorbornane?
The isomeric SMILES of Exo-2-aminonorbornane is C1C[C@@H]2C[C@H]1C[C@H]2N.
What is the XLogP3-AA value of Exo-2-aminonorbornane?
The XLogP3-AA value of Exo-2-aminonorbornane is 1.
Is Exo-2-aminonorbornane a canonicalized compound?
Yes, Exo-2-aminonorbornane is a canonicalized compound.