What is the molecular formula of Ethylboronic acid?
The molecular formula of Ethylboronic acid is C2H7BO2.
What is the molecular weight of Ethylboronic acid?
The molecular weight of Ethylboronic acid is 73.89 g/mol.
What is the IUPAC name of Ethylboronic acid?
The IUPAC name of Ethylboronic acid is ethylboronic acid.
What is the InChI of Ethylboronic acid?
The InChI of Ethylboronic acid is InChI=1S/C2H7BO2/c1-2-3(4)5/h4-5H,2H2,1H3.
What is the InChIKey of Ethylboronic acid?
The InChIKey of Ethylboronic acid is PAVZHTXVORCEHP-UHFFFAOYSA-N.
What is the canonical SMILES of Ethylboronic acid?
The canonical SMILES of Ethylboronic acid is B(CC)(O)O.
What is the CAS number of Ethylboronic acid?
The CAS number of Ethylboronic acid is 4433-63-0.
What is the European Community (EC) number of Ethylboronic acid?
The European Community (EC) number of Ethylboronic acid is 670-253-5.
What is the ChEMBL ID of Ethylboronic acid?
The ChEMBL ID of Ethylboronic acid is CHEMBL3218995.