What is the molecular formula of ethyl nitroacetate?
The molecular formula of ethyl nitroacetate is C4H7NO4.
What is the molecular weight of ethyl nitroacetate?
The molecular weight of ethyl nitroacetate is 133.10 g/mol.
What is the IUPAC name of ethyl nitroacetate?
The IUPAC name of ethyl nitroacetate is ethyl 2-nitroacetate.
What is the InChI of ethyl nitroacetate?
The InChI of ethyl nitroacetate is InChI=1S/C4H7NO4/c1-2-9-4(6)3-5(7)8/h2-3H2,1H3.
What is the InChIKey of ethyl nitroacetate?
The InChIKey of ethyl nitroacetate is FTKASJMIPSSXBP-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl nitroacetate?
The canonical SMILES of ethyl nitroacetate is CCOC(=O)C[N+](=O)[O-].
What is the CAS number of ethyl nitroacetate?
The CAS number of ethyl nitroacetate is 626-35-7.
What is the EC number of ethyl nitroacetate?
The EC number of ethyl nitroacetate is 210-944-7.
What is the UNII of ethyl nitroacetate?
The UNII of ethyl nitroacetate is 7SX8B7W4RD.
Is ethyl nitroacetate a canonicalized compound?
Yes, ethyl nitroacetate is a canonicalized compound.