What is the IUPAC Name for ethyl nipecotate?
The IUPAC Name for ethyl nipecotate is ethyl piperidine-3-carboxylate.
What is the molecular formula of ethyl nipecotate?
The molecular formula of ethyl nipecotate is C8H15NO2.
What is the molecular weight of ethyl nipecotate?
The molecular weight of ethyl nipecotate is 157.21 g/mol.
What is the InChI of ethyl nipecotate?
The InChI of ethyl nipecotate is InChI=1S/C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h7,9H,2-6H2,1H3.
What is the InChIKey of ethyl nipecotate?
The InChIKey of ethyl nipecotate is XIWBSOUNZWSFKU-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl nipecotate?
The canonical SMILES of ethyl nipecotate is CCOC(=O)C1CCCNC1.
What is the CAS number of ethyl nipecotate?
The CAS number of ethyl nipecotate is 5006-62-2.
What is the European Community (EC) number of ethyl nipecotate?
The European Community (EC) number of ethyl nipecotate is 225-681-3.
Is ethyl nipecotate a covalently-bonded unit?
Yes, ethyl nipecotate is a covalently-bonded unit.