What is the molecular formula of Ethyl 5-fluoro-2-methoxybenzoylformate?
The molecular formula is C11H11FO4.
What are some synonyms for Ethyl 5-fluoro-2-methoxybenzoylformate?
Some synonyms include ETHYL 5-FLUORO-2-METHOXYBENZOYLFORMATE, 873548-10-8, ethyl 2-(5-fluoro-2-methoxyphenyl)-2-oxoacetate, MFCD09801422, and DTXSID20641292.
What is the molecular weight of Ethyl 5-fluoro-2-methoxybenzoylformate?
The molecular weight is 226.20 g/mol.
What is the IUPAC name of Ethyl 5-fluoro-2-methoxybenzoylformate?
The IUPAC name is ethyl 2-(5-fluoro-2-methoxyphenyl)-2-oxoacetate.
What is the InChI of Ethyl 5-fluoro-2-methoxybenzoylformate?
The InChI is InChI=1S/C11H11FO4/c1-3-16-11(14)10(13)8-6-7(12)4-5-9(8)15-2/h4-6H,3H2,1-2H3.
What is the InChIKey of Ethyl 5-fluoro-2-methoxybenzoylformate?
The InChIKey is ROBOUAVAPGXKKB-UHFFFAOYSA-N.
What is the Canonical SMILES of Ethyl 5-fluoro-2-methoxybenzoylformate?
The Canonical SMILES is CCOC(=O)C(=O)C1=C(C=CC(=C1)F)OC.
What is the XLogP3-AA value of Ethyl 5-fluoro-2-methoxybenzoylformate?
The XLogP3-AA value is 2.1.
How many hydrogen bond donor counts does Ethyl 5-fluoro-2-methoxybenzoylformate have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethyl 5-fluoro-2-methoxybenzoylformate have?
It has 5 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.