What is the molecular formula of ethyl 3,5-dimethoxybenzoylformate?
The molecular formula of ethyl 3,5-dimethoxybenzoylformate is C12H14O5.
What are the synonyms for ethyl 3,5-dimethoxybenzoylformate?
The synonyms for ethyl 3,5-dimethoxybenzoylformate are ETHYL 3,5-DIMETHOXYBENZOYLFORMATE, 330551-16-1, ethyl 2-(3,5-dimethoxyphenyl)-2-oxoacetate, MFCD09801406, and ETHYL3,5-DIMETHOXYBENZOYLFORMATE.
What is the molecular weight of ethyl 3,5-dimethoxybenzoylformate?
The molecular weight of ethyl 3,5-dimethoxybenzoylformate is 238.24 g/mol.
What is the IUPAC name of ethyl 3,5-dimethoxybenzoylformate?
The IUPAC name of ethyl 3,5-dimethoxybenzoylformate is ethyl 2-(3,5-dimethoxyphenyl)-2-oxoacetate.
What is the InChI of ethyl 3,5-dimethoxybenzoylformate?
The InChI of ethyl 3,5-dimethoxybenzoylformate is InChI=1S/C12H14O5/c1-4-17-12(14)11(13)8-5-9(15-2)7-10(6-8)16-3/h5-7H,4H2,1-3H3.
What is the InChIKey of ethyl 3,5-dimethoxybenzoylformate?
The InChIKey of ethyl 3,5-dimethoxybenzoylformate is ZNRUMEIEXZJLTP-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl 3,5-dimethoxybenzoylformate?
The canonical SMILES of ethyl 3,5-dimethoxybenzoylformate is CCOC(=O)C(=O)C1=CC(=CC(=C1)OC)OC.
What is the CAS number of ethyl 3,5-dimethoxybenzoylformate?
The CAS number of ethyl 3,5-dimethoxybenzoylformate is 330551-16-1.
What is the heavy atom count of ethyl 3,5-dimethoxybenzoylformate?
The heavy atom count of ethyl 3,5-dimethoxybenzoylformate is 17.
Is ethyl 3,5-dimethoxybenzoylformate a canonicalized compound?
Yes, ethyl 3,5-dimethoxybenzoylformate is a canonicalized compound.
※ Please kindly note that our products are for research use only.