What is the molecular formula of Ethyl 2-methoxy-5-methylbenzoylformate?
The molecular formula of Ethyl 2-methoxy-5-methylbenzoylformate is C12H14O4.
What are the synonyms of Ethyl 2-methoxy-5-methylbenzoylformate?
The synonyms of Ethyl 2-methoxy-5-methylbenzoylformate are ethyl 2-(2-methoxy-5-methylphenyl)-2-oxoacetate, 859775-82-9, ethyl 2-(2-methoxy-5-methylphenyl)-2-oxoacetate, MFCD09801429, and DTXSID40641294.
What is the molecular weight of Ethyl 2-methoxy-5-methylbenzoylformate?
The molecular weight of Ethyl 2-methoxy-5-methylbenzoylformate is 222.24 g/mol.
What is the IUPAC name of Ethyl 2-methoxy-5-methylbenzoylformate?
The IUPAC name of Ethyl 2-methoxy-5-methylbenzoylformate is ethyl 2-(2-methoxy-5-methylphenyl)-2-oxoacetate.
What is the InChI of Ethyl 2-methoxy-5-methylbenzoylformate?
The InChI of Ethyl 2-methoxy-5-methylbenzoylformate is InChI=1S/C12H14O4/c1-4-16-12(14)11(13)9-7-8(2)5-6-10(9)15-3/h5-7H,4H2,1-3H3.
What is the InChIKey of Ethyl 2-methoxy-5-methylbenzoylformate?
The InChIKey of Ethyl 2-methoxy-5-methylbenzoylformate is STYOUXSMZIJPGG-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-methoxy-5-methylbenzoylformate?
The canonical SMILES of Ethyl 2-methoxy-5-methylbenzoylformate is CCOC(=O)C(=O)C1=C(C=CC(=C1)C)OC.
What is the XLogP3-AA value of Ethyl 2-methoxy-5-methylbenzoylformate?
The XLogP3-AA value of Ethyl 2-methoxy-5-methylbenzoylformate is 2.4.
How many hydrogen bond donor counts does Ethyl 2-methoxy-5-methylbenzoylformate have?
Ethyl 2-methoxy-5-methylbenzoylformate has 0 hydrogen bond donor counts.
How many rotatable bond counts does Ethyl 2-methoxy-5-methylbenzoylformate have?
Ethyl 2-methoxy-5-methylbenzoylformate has 5 rotatable bond counts.
※ Please kindly note that our products are for research use only.