What is the molecular formula of Ethyl 2,5-dimethoxybenzoylformate?
The molecular formula of Ethyl 2,5-dimethoxybenzoylformate is C12H14O5.
What are the synonyms for Ethyl 2,5-dimethoxybenzoylformate?
The synonyms for Ethyl 2,5-dimethoxybenzoylformate are ETHYL 2,5-DIMETHOXYBENZOYLFORMATE, 911047-42-2, ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate, MFCD09801405, ETHYL2,5-DIMETHOXYBENZOYLFORMATE.
What is the molecular weight of Ethyl 2,5-dimethoxybenzoylformate?
The molecular weight of Ethyl 2,5-dimethoxybenzoylformate is 238.24 g/mol.
What is the IUPAC name of Ethyl 2,5-dimethoxybenzoylformate?
The IUPAC name of Ethyl 2,5-dimethoxybenzoylformate is ethyl 2-(2,5-dimethoxyphenyl)-2-oxoacetate.
What is the InChI of Ethyl 2,5-dimethoxybenzoylformate?
The InChI of Ethyl 2,5-dimethoxybenzoylformate is InChI=1S/C12H14O5/c1-4-17-12(14)11(13)9-7-8(15-2)5-6-10(9)16-3/h5-7H,4H2,1-3H3.
What is the InChIKey of Ethyl 2,5-dimethoxybenzoylformate?
The InChIKey of Ethyl 2,5-dimethoxybenzoylformate is ZFXDELRBPYIPAX-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2,5-dimethoxybenzoylformate?
The canonical SMILES of Ethyl 2,5-dimethoxybenzoylformate is CCOC(=O)C(=O)C1=C(C=CC(=C1)OC)OC.
What is the CAS number of Ethyl 2,5-dimethoxybenzoylformate?
The CAS number of Ethyl 2,5-dimethoxybenzoylformate is 911047-42-2.
What is the XLogP3-AA value of Ethyl 2,5-dimethoxybenzoylformate?
The XLogP3-AA value of Ethyl 2,5-dimethoxybenzoylformate is 2.
Is Ethyl 2,5-dimethoxybenzoylformate a canonicalized compound?
Yes, Ethyl 2,5-dimethoxybenzoylformate is a canonicalized compound.
※ Please kindly note that our products are for research use only.