What is the molecular formula of Ethyl 2,4-dimethylbenzoylformate?
The molecular formula of Ethyl 2,4-dimethylbenzoylformate is C12H14O3.
What are the synonyms of Ethyl 2,4-dimethylbenzoylformate?
The synonyms of Ethyl 2,4-dimethylbenzoylformate are ETHYL 2,4-DIMETHYLBENZOYLFORMATE, 80120-33-8, ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate, MFCD09801408, DTXSID20531008.
What is the molecular weight of Ethyl 2,4-dimethylbenzoylformate?
The molecular weight of Ethyl 2,4-dimethylbenzoylformate is 206.24 g/mol.
What is the IUPAC name of Ethyl 2,4-dimethylbenzoylformate?
The IUPAC name of Ethyl 2,4-dimethylbenzoylformate is ethyl 2-(2,4-dimethylphenyl)-2-oxoacetate.
What is the InChI of Ethyl 2,4-dimethylbenzoylformate?
The InChI of Ethyl 2,4-dimethylbenzoylformate is InChI=1S/C12H14O3/c1-4-15-12(14)11(13)10-6-5-8(2)7-9(10)3/h5-7H,4H2,1-3H3.
What is the InChIKey of Ethyl 2,4-dimethylbenzoylformate?
The InChIKey of Ethyl 2,4-dimethylbenzoylformate is FMYSICOONSJFBX-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2,4-dimethylbenzoylformate?
The canonical SMILES of Ethyl 2,4-dimethylbenzoylformate is CCOC(=O)C(=O)C1=C(C=C(C=C1)C)C.
What is the CAS number of Ethyl 2,4-dimethylbenzoylformate?
The CAS number of Ethyl 2,4-dimethylbenzoylformate is 80120-33-8.
What is the XLogP3-AA value of Ethyl 2,4-dimethylbenzoylformate?
The XLogP3-AA value of Ethyl 2,4-dimethylbenzoylformate is 2.8.
Is Ethyl 2,4-dimethylbenzoylformate a canonicalized compound?
Yes, Ethyl 2,4-dimethylbenzoylformate is a canonicalized compound.
※ Please kindly note that our products are for research use only.