What is the molecular formula of ethyl 2,4,5-trimethylbenzoylformate?
The molecular formula of ethyl 2,4,5-trimethylbenzoylformate is C13H16O3.
What are the synonyms for ethyl 2,4,5-trimethylbenzoylformate?
The synonyms for ethyl 2,4,5-trimethylbenzoylformate are ETHYL 2,4,5-TRIMETHYLBENZOYLFORMATE, 80120-34-9, ethyl 2-oxo-2-(2,4,5-trimethylphenyl)acetate, MFCD09801443, and ETHYL2,4,5-TRIMETHYLBENZOYLFORMATE.
What is the molecular weight of ethyl 2,4,5-trimethylbenzoylformate?
The molecular weight of ethyl 2,4,5-trimethylbenzoylformate is 220.26 g/mol.
What is the IUPAC name of ethyl 2,4,5-trimethylbenzoylformate?
The IUPAC name of ethyl 2,4,5-trimethylbenzoylformate is ethyl 2-oxo-2-(2,4,5-trimethylphenyl)acetate.
What is the InChI of ethyl 2,4,5-trimethylbenzoylformate?
The InChI of ethyl 2,4,5-trimethylbenzoylformate is InChI=1S/C13H16O3/c1-5-16-13(15)12(14)11-7-9(3)8(2)6-10(11)4/h6-7H,5H2,1-4H3.
What is the InChIKey of ethyl 2,4,5-trimethylbenzoylformate?
The InChIKey of ethyl 2,4,5-trimethylbenzoylformate is PAYYIZNLYOSVAN-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl 2,4,5-trimethylbenzoylformate?
The canonical SMILES of ethyl 2,4,5-trimethylbenzoylformate is CCOC(=O)C(=O)C1=C(C=C(C(=C1)C)C)C.
What is the CAS number of ethyl 2,4,5-trimethylbenzoylformate?
The CAS number of ethyl 2,4,5-trimethylbenzoylformate is 80120-34-9.
Is ethyl 2,4,5-trimethylbenzoylformate a canonicalized compound?
Yes, ethyl 2,4,5-trimethylbenzoylformate is a canonicalized compound.