What is the molecular formula of Ethyl 2,3-epoxypropionate?
The molecular formula of Ethyl 2,3-epoxypropionate is C5H8O3.
What are the synonyms of Ethyl 2,3-epoxypropionate?
The synonyms of Ethyl 2,3-epoxypropionate are Ethyl oxirane-2-carboxylate, 4660-80-4, Ethyl 2,3-epoxypropanoate, Glycidic acid ethyl ester, and ethyl glycidate.
What is the molecular weight of Ethyl 2,3-epoxypropionate?
The molecular weight of Ethyl 2,3-epoxypropionate is 116.11 g/mol.
What is the IUPAC name of Ethyl 2,3-epoxypropionate?
The IUPAC name of Ethyl 2,3-epoxypropionate is ethyl oxirane-2-carboxylate.
What is the InChI of Ethyl 2,3-epoxypropionate?
The InChI of Ethyl 2,3-epoxypropionate is InChI=1S/C5H8O3/c1-2-7-5(6)4-3-8-4/h4H,2-3H2,1H3.
What is the InChIKey of Ethyl 2,3-epoxypropionate?
The InChIKey of Ethyl 2,3-epoxypropionate is LSGWSXRILNPXKJ-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2,3-epoxypropionate?
The canonical SMILES of Ethyl 2,3-epoxypropionate is CCOC(=O)C1CO1.
What is the CAS number of Ethyl 2,3-epoxypropionate?
The CAS number of Ethyl 2,3-epoxypropionate is 4660-80-4.
What is the monoisotopic mass of Ethyl 2,3-epoxypropionate?
The monoisotopic mass of Ethyl 2,3-epoxypropionate is 116.047344113 g/mol.
Is Ethyl 2,3-epoxypropionate a canonicalized compound?
Yes, Ethyl 2,3-epoxypropionate is a canonicalized compound.
※ Please kindly note that our products are for research use only.