What is the molecular formula of zidovudine?
The molecular formula of zidovudine is C10H13N5O4.
What is another name for zidovudine?
Another name for zidovudine is Azidothymidine.
What is the molecular weight of zidovudine?
The molecular weight of zidovudine is 267.24 g/mol.
When was zidovudine created?
Zidovudine was created on June 24, 2005.
What is the role of zidovudine as?
Zidovudine has a role as an antiviral drug, an antimetabolite, and a HIV-1 reverse transcriptase inhibitor.
What is the IUPAC Name of zidovudine?
The IUPAC Name of zidovudine is 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
What is the CAS number of zidovudine?
The CAS number of zidovudine is 30516-87-1.
What is the Canonical SMILES of zidovudine?
The Canonical SMILES of zidovudine is CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-].
What is the InChIKey of zidovudine?
The InChIKey of zidovudine is HBOMLICNUCNMMY-XLPZGREQSA-N.
What is the ChEMBL ID of zidovudine?
The ChEMBL ID of zidovudine is CHEMBL129.