What is the molecular formula of Epiprogoitrin?
The molecular formula of Epiprogoitrin is C11H19NO10S2.
What is the molecular weight of Epiprogoitrin?
The molecular weight of Epiprogoitrin is 389.4 g/mol.
When was Epiprogoitrin created and modified?
Epiprogoitrin was created on August 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Epiprogoitrin?
The IUPAC name of Epiprogoitrin is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1Z,3S)-3-hydroxy-N-sulfooxypent-4-enimidothioate.
What is the InChI of Epiprogoitrin?
The InChI of Epiprogoitrin is InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/b12-7-/t5-,6-,8-,9+,10-,11+/m1/s1.
What is the InChIKey of Epiprogoitrin?
The InChIKey of Epiprogoitrin is MYHSVHWQEVDFQT-KBHNZSCUSA-N.
What are the synonyms of Epiprogoitrin?
The synonyms of Epiprogoitrin are epi-Progoitrin, (2R)-2-Hydroxybut-3-enylglucosinolate, and Progoitrin.
What is the Canonical SMILES of Epiprogoitrin?
The Canonical SMILES of Epiprogoitrin is C=CC(CC(=NOS(=O)(=O)O)SC1C(C(C(C(O1)CO)O)O)O)O.
What is the XLogP3-AA value of Epiprogoitrin?
The XLogP3-AA value of Epiprogoitrin is -1.9.
Is Epiprogoitrin considered a canonical compound?
Yes, Epiprogoitrin is considered a canonical compound according to PubChem.