What is the molecular formula of bexagliflozin?
The molecular formula of bexagliflozin is C24H29ClO7.
What is the molecular weight of bexagliflozin?
The molecular weight of bexagliflozin is 464.9 g/mol.
What is the mechanism of action of bexagliflozin?
Bexagliflozin is a Sodium-Glucose Cotransporter 2 Inhibitor.
What is the InChIKey of bexagliflozin?
The InChIKey of bexagliflozin is BTCRKOKVYTVOLU-SJSRKZJXSA-N.
What is the canonical SMILES of bexagliflozin?
The canonical SMILES of bexagliflozin is C1CC1OCCOC2=CC=C(C=C2)CC3=C(C=CC(=C3)C4C(C(C(C(O4)CO)O)O)O)Cl.
What is the CAS number of bexagliflozin?
The CAS number of bexagliflozin is 1118567-05-7.
What is the UNII of bexagliflozin?
The UNII of bexagliflozin is EY00JF42FV.
How many hydrogen bond donor counts are there in bexagliflozin?
There are 4 hydrogen bond donor counts in bexagliflozin.
How many hydrogen bond acceptor counts are there in bexagliflozin?
There are 7 hydrogen bond acceptor counts in bexagliflozin.
What is the topological polar surface area of bexagliflozin?
The topological polar surface area of bexagliflozin is 109 Å2.