What is the molecular formula of Edta dimagnesium salt?
The molecular formula of Edta dimagnesium salt is C10H12Mg2N2O8.
What are some synonyms for Edta dimagnesium salt?
Some synonyms for Edta dimagnesium salt include dimagnesium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate, magnesium ethylenediaminetetraacetate, and magnesium 2,2',2'',2'''-(ethane-1,2-diylbis(azanetriyl))tetraacetate.
What is the molecular weight of Edta dimagnesium salt?
The molecular weight of Edta dimagnesium salt is 336.82 g/mol.
What is the parent compound of Edta dimagnesium salt?
The parent compound of Edta dimagnesium salt is Edetic Acid, which is represented by CID 6049.
What is the IUPAC Name of Edta dimagnesium salt?
The IUPAC Name of Edta dimagnesium salt is dimagnesium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate.
What is the InChI of Edta dimagnesium salt?
The InChI of Edta dimagnesium salt is InChI=1S/C10H16N2O8.2Mg/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+2/p-4.
What is the InChIKey of Edta dimagnesium salt?
The InChIKey of Edta dimagnesium salt is IDXKSDJIIYUSQP-UHFFFAOYSA-J.
What is the canonical SMILES of Edta dimagnesium salt?
The canonical SMILES of Edta dimagnesium salt is C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Mg+2].[Mg+2].
What is the CAS number of Edta dimagnesium salt?
The CAS number of Edta dimagnesium salt is 39377-66-7.
What is the hydrogen bond donor count of Edta dimagnesium salt?
The hydrogen bond donor count of Edta dimagnesium salt is 0.