What is the molecular formula of (E)-Guggulsterone?
The molecular formula of (E)-Guggulsterone is C21H28O2.
What is the molecular weight of (E)-Guggulsterone?
The molecular weight of (E)-Guggulsterone is 312.4 g/mol.
What is the IUPAC name of (E)-Guggulsterone?
The IUPAC name of (E)-Guggulsterone is (8R,9S,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthrene-3,16-dione.
What is the InChI of (E)-Guggulsterone?
The InChI of (E)-Guggulsterone is InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1.
What is the InChIKey of (E)-Guggulsterone?
The InChIKey of (E)-Guggulsterone is WDXRGPWQVHZTQJ-AUKWTSKRSA-N.
What is the canonical SMILES of (E)-Guggulsterone?
The canonical SMILES of (E)-Guggulsterone is CC=C1C(=O)CC2C1(CCC3C2CCC4=CC(=O)CCC34C)C.
What is the CAS number of (E)-Guggulsterone?
The CAS number of (E)-Guggulsterone is 39025-24-6.
What is the XLogP3-AA value of (E)-Guggulsterone?
The XLogP3-AA value of (E)-Guggulsterone is 3.9.
How many hydrogen bond donor counts does (E)-Guggulsterone have?
(E)-Guggulsterone has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does (E)-Guggulsterone have?
(E)-Guggulsterone has 2 hydrogen bond acceptor count.