What is the PubChem CID for E-11-Hexadecenyl acetate?
PubChem CID 5352788.
What is the molecular formula of E-11-Hexadecenyl acetate?
The molecular formula is C18H34O2.
What is the molecular weight of E-11-Hexadecenyl acetate?
The molecular weight is 282.5 g/mol.
What is the IUPAC name of E-11-Hexadecenyl acetate?
The IUPAC name is [(E)-hexadec-11-enyl] acetate.
What is the InChI of E-11-Hexadecenyl acetate?
The InChI is InChI=1S/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(2)19/h6-7H,3-5,8-17H2,1-2H3/b7-6+.
What is the InChIKey of E-11-Hexadecenyl acetate?
The InChIKey is BTKXLQSCEOHKTF-VOTSOKGWSA-N.
What are the synonyms for E-11-Hexadecenyl acetate?
The synonyms for E-11-Hexadecenyl acetate include 56218-72-5, 11E-Hexadecenyl acetate, [(E)-hexadec-11-enyl] acetate, and E-11-hexadecenyl acetate.
What is the CAS number of E-11-Hexadecenyl acetate?
The CAS number is 56218-72-5.
How many hydrogen bond acceptor counts does E-11-Hexadecenyl acetate have?
It has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does E-11-Hexadecenyl acetate have?
It has 15 rotatable bond counts.