What is the molecular formula of Drotaverine hydrochloride?
The molecular formula of Drotaverine hydrochloride is C24H32ClNO4.
What is the molecular weight of Drotaverine hydrochloride?
The molecular weight of Drotaverine hydrochloride is 434.0 g/mol.
What is the IUPAC name of Drotaverine hydrochloride?
The IUPAC name of Drotaverine hydrochloride is (1Z)-1-[(3,4-diethoxyphenyl)methylidene]-6,7-diethoxy-3,4-dihydro-2H-isoquinoline; hydrochloride.
What is the InChI of Drotaverine hydrochloride?
The InChI of Drotaverine hydrochloride is InChI=1S/C24H31NO4.ClH/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20;/h9-10,13-16,25H,5-8,11-12H2,1-4H3;1H/b20-13-.
What is the InChIKey of Drotaverine hydrochloride?
The InChIKey of Drotaverine hydrochloride is JBFLYOLJRKJYNV-MASIZSFYSA-N.
What is the canonical SMILES of Drotaverine hydrochloride?
The canonical SMILES of Drotaverine hydrochloride is CCOC1=C(C=C(C=C1)C=C2C3=CC(=C(C=C3CCN2)OCC)OCC)OCC.Cl.
How many hydrogen bond donor counts does Drotaverine hydrochloride have?
Drotaverine hydrochloride has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Drotaverine hydrochloride have?
Drotaverine hydrochloride has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does Drotaverine hydrochloride have?
Drotaverine hydrochloride has 9 rotatable bond counts.
What is the topological polar surface area of Drotaverine hydrochloride?
The topological polar surface area of Drotaverine hydrochloride is 49.2.
※ Please kindly note that our products are for research use only.