What is the PubChem CID of Drostanolone enanthate?
PubChem CID: 13014314
What is the molecular formula of Drostanolone enanthate?
Molecular Formula: C27H44O3
What are the synonyms of Drostanolone enanthate?
Synonyms: Drostanolone Enanthate, 13425-31-5, [(2R,5S,8R,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] heptanoate, Dromostanolone enanthate, SCHEMBL17433518
What is the molecular weight of Drostanolone enanthate?
Molecular Weight: 416.6 g/mol
What is the IUPAC name of Drostanolone enanthate?
IUPAC Name: [(2R,5S,8R,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] heptanoate
What is the InChI of Drostanolone enanthate?
InChI: InChI=1S/C27H44O3/c1-5-6-7-8-9-25(29)30-24-13-12-21-20-11-10-19-16-23(28)18(2)17-27(19,4)22(20)14-15-26(21,24)3/h18-22,24H,5-17H2,1-4H3/t18-,19+,20+,21+,22+,24+,26+,27+/m1/s1
What is the InChIKey of Drostanolone enanthate?
InChIKey: ZNYZYASFVYLKPE-PCWAKFEDSA-N
What is the canonical SMILES of Drostanolone enanthate?
Canonical SMILES: CCCCCCC(=O)OC1CCC2C1(CCC3C2CCC4C3(CC(C(=O)C4)C)C)
What is the XLogP3 value of Drostanolone enanthate?
XLogP3: 7.3
What is the CAS number of Drostanolone enanthate?
CAS: 13425-31-5
What is the structure of Drostanolone enanthate?
The structure of Drostanolone enanthate is not provided in the reference.
What are the synonyms for Drostanolone enanthate?
The synonyms for Drostanolone enanthate are Drostanolone Enanthate, 13425-31-5, [(2R,5S,8R,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] heptanoate, Dromostanolone enanthate, and SCHEMBL17433518.
When was Drostanolone enanthate created?
Drostanolone enanthate was created on February 8, 2007.
When was Drostanolone enanthate last modified?
Drostanolone enanthate was last modified on December 2, 2023.