What is the molecular formula of doxapram?
The molecular formula of doxapram is C24H30N2O2.
What is the molecular weight of doxapram?
The molecular weight of doxapram is 378.5 g/mol.
What are some synonyms for doxapram?
Some synonyms for doxapram include Dopram, 1-Ethyl-4-(2-morpholinoethyl)-3,3-diphenylpyrrolidin-2-one, and Doxapramum.
What is the role of doxapram as?
Doxapram is described as a central and respiratory stimulant with a brief duration of action, used for the temporary treatment of acute respiratory failure and postoperative respiratory depression.
What is the IUPAC name of doxapram?
The IUPAC name of doxapram is 1-ethyl-4-(2-morpholin-4-ylethyl)-3,3-diphenylpyrrolidin-2-one.
What is the InChIKey of doxapram?
The InChIKey of doxapram is XFDJYSQDBULQSI-UHFFFAOYSA-N.
What is the Canonical SMILES representation of doxapram?
The Canonical SMILES representation of doxapram is CCN1CC(C(C1=O)(C2=CC=CC=C2)C3=CC=CC=C3)CCN4CCOCC4.
What is the CAS registry number of doxapram?
The CAS registry number of doxapram is 309-29-5.
What is the European Community (EC) number of doxapram?
The European Community (EC) number of doxapram is 206-216-3.
What is the XLogP3-AA value of doxapram?
The XLogP3-AA value of doxapram is 3.3.