What is the molecular formula of DMFL-CBP?
The molecular formula of DMFL-CBP is C39H28N2.
What is the molecular weight of DMFL-CBP?
The molecular weight of DMFL-CBP is 524.7 g/mol.
When was DMFL-CBP created?
DMFL-CBP was created on October 30, 2011.
What is the IUPAC name of DMFL-CBP?
The IUPAC name of DMFL-CBP is 9-(7-carbazol-9-yl-9,9-dimethylfluoren-2-yl)carbazole.
What is the InChI of DMFL-CBP?
The InChI of DMFL-CBP is InChI=1S/C39H28N2/c1-39(2)33-23-25(40-35-15-7-3-11-29(35)30-12-4-8-16-36(30)40)19-21-27(33)28-22-20-26(24-34(28)39)41-37-17-9-5-13-31(37)32-14-6-10-18-38(32)41/h3-24H,1-2H3.
What is the InChIKey of DMFL-CBP?
The InChIKey of DMFL-CBP is IEQGNDONCZPWMW-UHFFFAOYSA-N.
What is the Canonical SMILES of DMFL-CBP?
The Canonical SMILES of DMFL-CBP is CC1(C2=C(C=CC(=C2)N3C4=CC=CC=C4C5=CC=CC=C53)C6=C1C=C(C=C6)N7C8=CC=CC=C8C9=CC=CC=C97)C.
What is the CAS number of DMFL-CBP?
The CAS number of DMFL-CBP is 226958-06-1.
What is the XLogP3-AA value of DMFL-CBP?
The XLogP3-AA value of DMFL-CBP is 10.6.
Is DMFL-CBP a canonicalized compound?
Yes, DMFL-CBP is a canonicalized compound.