If you have any other questions or need other size, please get a quote.
Catalog Number
ACM6576518
Product Name
Distamycin a hydrochloride
Structure
CAS
6576-51-8
Category
Heterocyclic Organic Compound
Synonyms
estalimicinaclorhidrato;fi6426;herperal;stallimycinhydrochloride;DISTAMYCIN A HCL;DISTAMYCIN A HYDROCHLORIDE;distamycin A hydrochloride from*streptomyces dist;N-[5-[[(3-amino-3-iminopropyl)amino]carbonyl]-1-methyl-1H-pyrrol-3-yl]-4-[[[4-(formylamino)-1-methyl-1H-pyrrol-2-yl]carbonyl]amino]-1-methyl-1H-pyrrole-2-carboxamide monohydrochloride
What is the molecular formula of Distamycin a hydrochloride?
The molecular formula of Distamycin a hydrochloride is C22H28ClN9O4.
What is the molecular weight of Distamycin a hydrochloride?
The molecular weight of Distamycin a hydrochloride is 518.0 g/mol.
What is the IUPAC name of Distamycin a hydrochloride?
The IUPAC name of Distamycin a hydrochloride is N-[5-[[5-[(3-amino-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]carbamoyl]-1-methylpyrrol-3-yl]-4-formamido-1-methylpyrrole-2-carboxamide;hydrochloride.
What is the InChI of Distamycin a hydrochloride?
The InChI of Distamycin a hydrochloride is InChI=1S/C22H27N9O4.ClH/c1-29-9-13(26-12-32)6-17(29)21(34)28-15-8-18(31(3)11-15)22(35)27-14-7-16(30(2)10-14)20(33)25-5-4-19(23)24;/h6-12H,4-5H2,1-3H3,(H3,23,24)(H,25,33)(H,26,32)(H,27,35)(H,28,34);1H.
What is the molecular formula of Distamycin?
The molecular formula of Distamycin is CID 3115.
What is the CAS number of Distamycin a hydrochloride?
The CAS number of Distamycin a hydrochloride is 6576-51-8.
What is the ChEMBL ID of Distamycin a hydrochloride?
The ChEMBL ID of Distamycin a hydrochloride is CHEMBL19687.
What is the NCI Thesaurus Code of Distamycin a hydrochloride?
The NCI Thesaurus Code of Distamycin a hydrochloride is C152423.
What is the hydrogen bond donor count of Distamycin a hydrochloride?
The hydrogen bond donor count of Distamycin a hydrochloride is 7.
What is the hydrogen bond acceptor count of Distamycin a hydrochloride?
The hydrogen bond acceptor count of Distamycin a hydrochloride is 5.
※ Please kindly note that our products are for research use only.