What is the molecular formula of Disperse Yellow Se-Fl?
The molecular formula of Disperse Yellow Se-Fl is C18H15N3O4S.
What is the molecular weight of Disperse Yellow Se-Fl?
The molecular weight of Disperse Yellow Se-Fl is 369.4 g/mol.
What is the IUPAC name of Disperse Yellow Se-Fl?
The IUPAC name of Disperse Yellow Se-Fl is 4-anilino-3-nitro-N-phenylbenzenesulfonamide.
What is the InChIKey of Disperse Yellow Se-Fl?
The InChIKey of Disperse Yellow Se-Fl is BBFRYSKTTHYWQZ-UHFFFAOYSA-N.
What other identifiers are associated with Disperse Yellow Se-Fl?
Other identifiers associated with Disperse Yellow Se-Fl include CAS number 5124-25-4, UNII XFL4U655CN, and ChEMBL ID CHEMBL1708990.
What is the Canonical SMILES notation for Disperse Yellow Se-Fl?
The Canonical SMILES notation for Disperse Yellow Se-Fl is C1=CC=C(C=C1)NC2=C(C=C(C=C2)S(=O)(=O)NC3=CC=CC=C3)[N+](=O)[O-].
What is the XLogP3-AA value of Disperse Yellow Se-Fl?
The XLogP3-AA value of Disperse Yellow Se-Fl is 4.4.
How many hydrogen bond donor counts are in Disperse Yellow Se-Fl?
There are 2 hydrogen bond donor counts in Disperse Yellow Se-Fl.
What is the topological polar surface area of Disperse Yellow Se-Fl?
The topological polar surface area of Disperse Yellow Se-Fl is 112 Ų.
How many rotatable bond counts are in Disperse Yellow Se-Fl?
There are 5 rotatable bond counts in Disperse Yellow Se-Fl.