What is the molecular formula of Diphosphorus tetraiodide?
The molecular formula is P2I4.
What is the molecular weight of Diphosphorus tetraiodide?
The molecular weight is 569.5654 g/mol.
What is the IUPAC name of Diphosphorus tetraiodide?
The IUPAC name is diiodophosphanyl(diiodo)phosphane.
What is the InChI of Diphosphorus tetraiodide?
The InChI is InChI=1S/I4P2/c1-5(2)6(3)4.
What is the InChIKey of Diphosphorus tetraiodide?
The InChIKey is YXXQTQYRRHHWFL-UHFFFAOYSA-N.
What is the canonical SMILES of Diphosphorus tetraiodide?
The canonical SMILES is P(P(I)I)(I)I.
What is the CAS number of Diphosphorus tetraiodide?
The CAS number is 13455-00-0.
What is the European Community (EC) number of Diphosphorus tetraiodide?
The EC number is 236-646-7.
What is the DSSTox Substance ID of Diphosphorus tetraiodide?
The DSSTox Substance ID is DTXSID6065474.
Is Diphosphorus tetraiodide canonicalized as a compound?
Yes, it is canonicalized as a compound.