What is the molecular formula of Diphenylpropylphosphine?
The molecular formula of Diphenylpropylphosphine is C15H17P.
What is the molecular weight of Diphenylpropylphosphine?
The molecular weight of Diphenylpropylphosphine is 228.27 g/mol.
What is the IUPAC name of Diphenylpropylphosphine?
The IUPAC name of Diphenylpropylphosphine is diphenyl(propyl)phosphane.
What is the InChI of Diphenylpropylphosphine?
The InChI of Diphenylpropylphosphine is InChI=1S/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3.
What is the InChIKey of Diphenylpropylphosphine?
The InChIKey of Diphenylpropylphosphine is AAXGWYDSLJUQLN-UHFFFAOYSA-N.
What is the canonical SMILES of Diphenylpropylphosphine?
The canonical SMILES of Diphenylpropylphosphine is CCCP(C1=CC=CC=C1)C2=CC=CC=C2.
What is the CAS number of Diphenylpropylphosphine?
The CAS number of Diphenylpropylphosphine is 7650-84-2.
What is the EC (European Community) number of Diphenylpropylphosphine?
The EC number of Diphenylpropylphosphine is 231-607-0.
Is Diphenylpropylphosphine a canonicalized compound?
Yes, Diphenylpropylphosphine is a canonicalized compound.