What is the PubChem CID of diphenylgermane?
The PubChem CID of diphenylgermane is 6330549.
What is the molecular formula of diphenylgermane?
The molecular formula of diphenylgermane is C12H10Ge.
Can you provide any synonyms for diphenylgermane?
Yes, the synonyms for diphenylgermane include diphenylgermylene and Germane, diphenyl-.
What is the molecular weight of diphenylgermane?
The molecular weight of diphenylgermane is 226.84 g/mol.
How is the InChI of diphenylgermane computed?
The InChI of diphenylgermane is computed by InChI 1.0.5.
What is the InChIKey of diphenylgermane?
The InChIKey of diphenylgermane is WNGVGKSMZIOFON-UHFFFAOYSA-N.
Can you provide the canonical SMILES representation of diphenylgermane?
Yes, the canonical SMILES representation of diphenylgermane is C1=CC=C(C=C1)[Ge]C2=CC=CC=C2.
What is the CAS number of diphenylgermane?
The CAS number of diphenylgermane is 1675-58-7.
What is the European Community (EC) number of diphenylgermane?
The European Community (EC) number of diphenylgermane is 801-851-8.
Is diphenylgermane a canonicalized compound according to PubChem?
Yes, diphenylgermane is a canonicalized compound according to PubChem.