What is the molecular formula of dimethyl 2-isocyanatoterephthalate?
The molecular formula is C11H9NO5.
What are the synonyms for dimethyl 2-isocyanatoterephthalate?
The synonyms are dimethyl 2-isocyanatoterephthalate, dimethyl 2-isocyanatobenzene-1,4-dicarboxylate, and 1,4-dimethyl 2-isocyanatobenzene-1,4-dicarboxylate.
What is the molecular weight of dimethyl 2-isocyanatoterephthalate?
The molecular weight is 235.19 g/mol.
What is the IUPAC name of dimethyl 2-isocyanatoterephthalate?
The IUPAC name is dimethyl 2-isocyanatobenzene-1,4-dicarboxylate.
What is the InChI of dimethyl 2-isocyanatoterephthalate?
The InChI is InChI=1S/C11H9NO5/c1-16-10(14)7-3-4-8(11(15)17-2)9(5-7)12-6-13/h3-5H,1-2H3.
What is the InChIKey of dimethyl 2-isocyanatoterephthalate?
The InChIKey is VLBOVVSWDHUHJK-UHFFFAOYSA-N.
What is the canonical SMILES of dimethyl 2-isocyanatoterephthalate?
The canonical SMILES is COC(=O)C1=CC(=C(C=C1)C(=O)OC)N=C=O.
What is the XLogP3-AA value of dimethyl 2-isocyanatoterephthalate?
The XLogP3-AA value is 2.4.
How many hydrogen bond donor counts does dimethyl 2-isocyanatoterephthalate have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does dimethyl 2-isocyanatoterephthalate have?
It has 6 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.