What is the molecular formula of Diisopropyl carbonate?
The molecular formula of Diisopropyl carbonate is C7H14O3.
What is the molecular weight of Diisopropyl carbonate?
The molecular weight of Diisopropyl carbonate is 146.18 g/mol.
What is the IUPAC name of Diisopropyl carbonate?
The IUPAC name of Diisopropyl carbonate is dipropan-2-yl carbonate.
What is the InChI of Diisopropyl carbonate?
The InChI of Diisopropyl carbonate is InChI=1S/C7H14O3/c1-5(2)9-7(8)10-6(3)4/h5-6H,1-4H3.
What is the InChIKey of Diisopropyl carbonate?
The InChIKey of Diisopropyl carbonate is JMPVESVJOFYWTB-UHFFFAOYSA-N.
What is the canonical SMILES of Diisopropyl carbonate?
The canonical SMILES of Diisopropyl carbonate is CC(C)OC(=O)OC(C)C.
What is the CAS number of Diisopropyl carbonate?
The CAS number of Diisopropyl carbonate is 6482-34-4.
What is the EC number of Diisopropyl carbonate?
The EC number of Diisopropyl carbonate is 873-526-9.
What is the Hydrogen Bond Acceptor Count of Diisopropyl carbonate?
The Hydrogen Bond Acceptor Count of Diisopropyl carbonate is 3.
Is Diisopropyl carbonate a canonicalized compound?
Yes, Diisopropyl carbonate is a canonicalized compound.