What is the molecular formula of diisobutyl succinate?
The molecular formula of diisobutyl succinate is C12H22O4.
What is the molecular weight of diisobutyl succinate?
The molecular weight of diisobutyl succinate is 230.30 g/mol.
What is the IUPAC name of diisobutyl succinate?
The IUPAC name of diisobutyl succinate is bis(2-methylpropyl) butanedioate.
What is the InChI of diisobutyl succinate?
The InChI of diisobutyl succinate is InChI=1S/C12H22O4/c1-9(2)7-15-11(13)5-6-12(14)16-8-10(3)4/h9-10H,5-8H2,1-4H3.
What is the InChIKey of diisobutyl succinate?
The InChIKey of diisobutyl succinate is QCOAPBRVQHMEPF-UHFFFAOYSA-N.
What is the canonical SMILES of diisobutyl succinate?
The canonical SMILES of diisobutyl succinate is CC(C)COC(=O)CCC(=O)OCC(C)C.
What is the CAS number of diisobutyl succinate?
The CAS number of diisobutyl succinate is 925-06-4.
What is the European Community (EC) number of diisobutyl succinate?
The European Community (EC) number of diisobutyl succinate is 213-113-7.
What is the UNII of diisobutyl succinate?
The UNII of diisobutyl succinate is 1241X4J800.
What is the XLogP3 value of diisobutyl succinate?
The XLogP3 value of diisobutyl succinate is 3.1.