What is the PubChem CID of Dihydrobetulonic acid?
The PubChem CID of Dihydrobetulonic acid is 467411.
What is the molecular formula of Dihydrobetulonic acid?
The molecular formula of Dihydrobetulonic acid is C30H48O3.
What are the synonyms of Dihydrobetulonic acid?
The synonyms of Dihydrobetulonic acid include dihydrobetulonic acid, CHEMBL296567, SCHEMBL3276418, and 3-Deoxy-3-oxo-dihydrobetulinic acid.
What is the molecular weight of Dihydrobetulonic acid?
The molecular weight of Dihydrobetulonic acid is 456.7 g/mol.
When was Dihydrobetulonic acid created?
Dihydrobetulonic acid was created on August 1, 2005.
When was Dihydrobetulonic acid last modified?
Dihydrobetulonic acid was last modified on December 2, 2023.
What is the IUPAC Name of Dihydrobetulonic acid?
The IUPAC Name of Dihydrobetulonic acid is (1S,3aS,5aR,5bR,7aR,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-9-oxo-1-propan-2-yl-2,3,4,5,6,7,7a,10,11,11b,12,13,13a,13b-tetradecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid.
What is the InChI of Dihydrobetulonic acid?
The InChI of Dihydrobetulonic acid is InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h18-22,24H,8-17H2,1-7H3,(H,32,33)/t19-,20+,21-,22+,24+,27-,28+,29+,30-/m0/s1.
What is the InChIKey of Dihydrobetulonic acid?
The InChIKey of Dihydrobetulonic acid is OUAPNSVTUJNUMW-SVAFSPIFSA-N.
What is the Canonical SMILES of Dihydrobetulonic acid?
The Canonical SMILES of Dihydrobetulonic acid is CC(C)C1CCC2(C1C3CCC4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)C(=O)O.