What is the molecular formula of dihydrobetulinic acid?
The molecular formula of dihydrobetulinic acid is C30H50O3.
What are the synonyms of dihydrobetulinic acid?
The synonyms of dihydrobetulinic acid are Dihydrobetulinic acid, (3beta)-3-Hydroxylupan-28-oic acid, 25488-53-3, and 20,29-dihydrobetulinic acid.
What is the molecular weight of dihydrobetulinic acid?
The molecular weight of dihydrobetulinic acid is 458.7 g/mol.
What is the IUPAC name of dihydrobetulinic acid?
The IUPAC name of dihydrobetulinic acid is (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-9-hydroxy-5a,5b,8,8,11a-pentamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylic acid.
What is the InChI of dihydrobetulinic acid?
The InChI of dihydrobetulinic acid is InChI=1S/C30H50O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h18-24,31H,8-17H2,1-7H3,(H,32,33)/t19-,20+,21-,22,23,24+,27+,28+,29+,30-/m0/s1.
What is the InChIKey of dihydrobetulinic acid?
The InChIKey of dihydrobetulinic acid is PZXJOHSZQAEJFE-FZFNOLFKSA-N.
What is the canonical SMILES of dihydrobetulinic acid?
The canonical SMILES of dihydrobetulinic acid is CC(C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)C(=O)O.
What is the CAS number of dihydrobetulinic acid?
The CAS number of dihydrobetulinic acid is 25488-53-3.
How many hydrogen bond donor count does dihydrobetulinic acid have?
Dihydrobetulinic acid has 2 hydrogen bond donor count.
How many rotatable bond count does dihydrobetulinic acid have?
The rotatable bond count of dihydrobetulinic acid is not provided in the reference.