What is the PubChem CID for Dihydrobetulin?
The PubChem CID for Dihydrobetulin is 10527286.
What is the molecular formula of Dihydrobetulin?
The molecular formula of Dihydrobetulin is C30H52O2.
What are the synonyms for Dihydrobetulin?
The synonyms for Dihydrobetulin are DIHYDROBETULIN, CHEMBL422042, SCHEMBL3780917, and BDBM50601893.
What is the molecular weight of Dihydrobetulin?
The molecular weight of Dihydrobetulin is 444.7 g/mol.
When was Dihydrobetulin created?
Dihydrobetulin was created on October 25, 2006.
When was Dihydrobetulin last modified?
Dihydrobetulin was last modified on November 25, 2023.
What is the IUPAC name of Dihydrobetulin?
The IUPAC name of Dihydrobetulin is (1S,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-propan-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
What is the InChI of Dihydrobetulin?
The InChI of Dihydrobetulin is InChI=1S/C30H52O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h19-25,31-32H,8-18H2,1-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1.
What is the InChIKey of Dihydrobetulin?
The InChIKey of Dihydrobetulin is JZZMDHQYBFQRMW-ROUWMTJPSA-N.
What is the Canonical SMILES of Dihydrobetulin?
The Canonical SMILES of Dihydrobetulin is CC(C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)CO.