What is the molecular formula of Diethyl(3-pyridyl)borane?
The molecular formula of Diethyl(3-pyridyl)borane is C9H14BN.
What is the molecular weight of Diethyl(3-pyridyl)borane?
The molecular weight of Diethyl(3-pyridyl)borane is 147.03 g/mol.
What is the IUPAC name of Diethyl(3-pyridyl)borane?
The IUPAC name of Diethyl(3-pyridyl)borane is diethyl(pyridin-3-yl)borane.
What is the InChI of Diethyl(3-pyridyl)borane?
The InChI of Diethyl(3-pyridyl)borane is InChI=1S/C9H14BN/c1-3-10(4-2)9-6-5-7-11-8-9/h5-8H,3-4H2,1-2H3.
What is the InChIKey of Diethyl(3-pyridyl)borane?
The InChIKey of Diethyl(3-pyridyl)borane is OJKBCQOJVMAHDX-UHFFFAOYSA-N.
What is the canonical SMILES of Diethyl(3-pyridyl)borane?
The canonical SMILES of Diethyl(3-pyridyl)borane is B(CC)(CC)C1=CN=CC=C1.
What is the CAS number of Diethyl(3-pyridyl)borane?
The CAS number of Diethyl(3-pyridyl)borane is 89878-14-8.
What is the European Community (EC) number of Diethyl(3-pyridyl)borane?
The European Community (EC) number of Diethyl(3-pyridyl)borane is 627-082-6.
What is the DSSTox Substance ID of Diethyl(3-pyridyl)borane?
The DSSTox Substance ID of Diethyl(3-pyridyl)borane is DTXSID00349087.
Is Diethyl(3-pyridyl)borane a covalently-bonded unit?
Yes, Diethyl(3-pyridyl)borane is a covalently-bonded unit.