What is the molecular formula of dibenz[a,c]anthracene?
The molecular formula of dibenz[a,c]anthracene is C22H14.
What is the molecular weight of dibenz[a,c]anthracene?
The molecular weight of dibenz[a,c]anthracene is 278.3 g/mol.
What is the IUPAC name of dibenz[a,c]anthracene?
The IUPAC name of dibenz[a,c]anthracene is benzo[b]triphenylene.
What is the InChI of dibenz[a,c]anthracene?
The InChI of dibenz[a,c]anthracene is InChI=1S/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H.
What is the InChIKey of dibenz[a,c]anthracene?
The InChIKey of dibenz[a,c]anthracene is RAASUWZPTOJQAY-UHFFFAOYSA-N.
What is the canonical SMILES of dibenz[a,c]anthracene?
The canonical SMILES of dibenz[a,c]anthracene is C1=CC=C2C=C3C4=CC=CC=C4C5=CC=CC=C5C3=CC2=C1.
What is the CAS number of dibenz[a,c]anthracene?
The CAS number of dibenz[a,c]anthracene is 215-58-7.
How many hydrogen bond donor count does dibenz[a,c]anthracene have?
Dibenz[a,c]anthracene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does dibenz[a,c]anthracene have?
Dibenz[a,c]anthracene has 0 hydrogen bond acceptor count.