What is the molecular formula of Diallyldibutyltin?
The molecular formula of Diallyldibutyltin is C14H28Sn.
What is the molecular weight of Diallyldibutyltin?
The molecular weight of Diallyldibutyltin is 315.08 g/mol.
What is the IUPAC name of Diallyldibutyltin?
The IUPAC name of Diallyldibutyltin is dibutyl-bis(prop-2-enyl)stannane.
What is the InChI of Diallyldibutyltin?
The InChI of Diallyldibutyltin is InChI=1S/2C4H9.2C3H5.Sn/c2*1-3-4-2;2*1-3-2;/h2*1,3-4H2,2H3;2*3H,1-2H2;.
What is the InChIKey of Diallyldibutyltin?
The InChIKey of Diallyldibutyltin is LCGVYMRFNOWPGQ-UHFFFAOYSA-N.
What is the canonical SMILES of Diallyldibutyltin?
The canonical SMILES of Diallyldibutyltin is CCCC[Sn](CCCC)(CC=C)CC=C.
What is the CAS number of Diallyldibutyltin?
The CAS number of Diallyldibutyltin is 15336-98-8.
What is the European Community (EC) number of Diallyldibutyltin?
The European Community (EC) number of Diallyldibutyltin is 239-368-4.
What is the UNII of Diallyldibutyltin?
The UNII of Diallyldibutyltin is C7D5C4JMG2.
What is the DSSTox Substance ID of Diallyldibutyltin?
The DSSTox Substance ID of Diallyldibutyltin is DTXSID10165316.