What is the molecular formula of Deoxynivalenol?
The molecular formula of Deoxynivalenol is C15H20O6.
What is another name for Deoxynivalenol?
Another name for Deoxynivalenol is Vomitoxin.
What is the molecular weight of Deoxynivalenol?
The molecular weight of Deoxynivalenol is 296.31 g/mol.
What is the IUPAC name of Deoxynivalenol?
The IUPAC name of Deoxynivalenol is (1R,2R,3S,7R,9R,10R,12S)-3,10-dihydroxy-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.0 2,7]dodec-5-ene-12,2'-oxirane]-4-one.
Where is Deoxynivalenol naturally found?
Deoxynivalenol is a natural product found in Euglena gracilis, Fusarium culmorum, and Fusarium graminearum.
What is the InChIKey of Deoxynivalenol?
The InChIKey of Deoxynivalenol is LINOMUASTDIRTM-QGRHZQQGSA-N.
What is the Canonical SMILES of Deoxynivalenol?
The Canonical SMILES of Deoxynivalenol is CC1=CC2C(C(C1=O)O)(C3(CC(C(C34CO4)O2)O)C)CO.
What is the CAS number of Deoxynivalenol?
The CAS number of Deoxynivalenol is 51481-10-8.
How many hydrogen bond donor counts does Deoxynivalenol have?
Deoxynivalenol has 3 hydrogen bond donor counts.
What is the topological polar surface area of Deoxynivalenol?
The topological polar surface area of Deoxynivalenol is 99.52.