What is the molecular formula of Demiditraz?
The molecular formula of Demiditraz is C13H16N2.
When was Demiditraz created and modified?
Demiditraz was created on 2008-03-03 and modified on 2023-12-30.
What is the IUPAC name of Demiditraz?
The IUPAC name of Demiditraz is 2-[(1S)-1-(2,3-dimethylphenyl)ethyl]-1H-imidazole.
What is the molecular weight of Demiditraz?
The molecular weight of Demiditraz is 200.28 g/mol.
What is the InChIKey of Demiditraz?
The InChIKey of Demiditraz is FXJRDUKXWHFPND-NSHDSACASA-N.
What is the Canonical SMILES of Demiditraz?
The Canonical SMILES of Demiditraz is CC1=C(C(=CC=C1)C(C)C2=NC=CN2)C.
What is the CAS number of Demiditraz?
The CAS number of Demiditraz is 944263-65-4.
How many hydrogen bond donor counts are there in Demiditraz?
There is 1 hydrogen bond donor count in Demiditraz.
What is the topological polar surface area of Demiditraz?
The topological polar surface area of Demiditraz is 28.7 Ų.
Is the compound of Demiditraz canonicalized?
Yes, the compound of Demiditraz is canonicalized.