What is the molecular formula of dehydroepiandrosterone enanthate?
The molecular formula of dehydroepiandrosterone enanthate is C26H40O3.
What is the molecular weight of dehydroepiandrosterone enanthate?
The molecular weight of dehydroepiandrosterone enanthate is 400.6 g/mol.
What is the IUPAC name of dehydroepiandrosterone enanthate?
The IUPAC name of dehydroepiandrosterone enanthate is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] heptanoate.
What is the InChI of dehydroepiandrosterone enanthate?
The InChI of dehydroepiandrosterone enanthate is InChI=1S/C26H40O3/c1-4-5-6-7-8-24(28)29-19-13-15-25(2)18(17-19)9-10-20-21-11-12-23(27)26(21,3)16-14-22(20)25/h9,19-22H,4-8,10-17H2,1-3H3/t19-,20-,21-,22-,25-,26-/m0/s1.
What is the InChIKey of dehydroepiandrosterone enanthate?
The InChIKey of dehydroepiandrosterone enanthate is HHENOUDBWKNPAB-BNCSLUSBSA-N.
What is the canonical SMILES of dehydroepiandrosterone enanthate?
The canonical SMILES of dehydroepiandrosterone enanthate is CCCCCCC(=O)OC1CCC2(C3CCC4(C(C3CC=C2C1)CCC4=O)C)C.
How many hydrogen bond donor counts does dehydroepiandrosterone enanthate have?
Dehydroepiandrosterone enanthate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does dehydroepiandrosterone enanthate have?
Dehydroepiandrosterone enanthate has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does dehydroepiandrosterone enanthate have?
Dehydroepiandrosterone enanthate has 7 rotatable bond counts.
What is the topological polar surface area of dehydroepiandrosterone enanthate?
The topological polar surface area of dehydroepiandrosterone enanthate is 43.4Ų.