What is the molecular formula of Decahydro-isoquinoline-1-carboxylic acid?
The molecular formula is C10H17NO2.
What are the synonyms of Decahydro-isoquinoline-1-carboxylic acid?
The synonyms are Decahydro-isoquinoline-1-carboxylic acid, Decahydroisoquinoline-1-carboxylic acid, and 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-1-carboxylic Acid.
What is the molecular weight of Decahydro-isoquinoline-1-carboxylic acid?
The molecular weight is 183.25 g/mol.
What is the IUPAC name of Decahydro-isoquinoline-1-carboxylic acid?
The IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-1-carboxylic acid.
What is the InChI of Decahydro-isoquinoline-1-carboxylic acid?
The InChI is InChI=1S/C10H17NO2/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9/h7-9,11H,1-6H2,(H,12,13).
What is the InChIKey of Decahydro-isoquinoline-1-carboxylic acid?
The InChIKey is VVWUWTAURHNLGY-UHFFFAOYSA-N.
What is the canonical SMILES of Decahydro-isoquinoline-1-carboxylic acid?
The canonical SMILES is C1CCC2C(C1)CCNC2C(=O)O.
What is the CAS number of Decahydro-isoquinoline-1-carboxylic acid?
The CAS number is 169390-26-5.
What is the XLogP3-AA value of Decahydro-isoquinoline-1-carboxylic acid?
The XLogP3-AA value is -0.5.
Is Decahydro-isoquinoline-1-carboxylic acid a canonicalized compound?
Yes, Decahydro-isoquinoline-1-carboxylic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.