What is the molecular formula of D-Propargylglycine?
The molecular formula of D-Propargylglycine is C5H7NO2.
What is the molecular weight of D-Propargylglycine?
The molecular weight of D-Propargylglycine is 113.11 g/mol.
What is the IUPAC name of D-Propargylglycine?
The IUPAC name of D-Propargylglycine is (2R)-2-aminopent-4-ynoic acid.
What is the InChI of D-Propargylglycine?
The InChI of D-Propargylglycine is InChI=1S/C5H7NO2/c1-2-3-4(6)5(7)8/h1,4H,3,6H2,(H,7,8)/t4-/m1/s1.
What is the InChIKey of D-Propargylglycine?
The InChIKey of D-Propargylglycine is DGYHPLMPMRKMPD-SCSAIBSYSA-N.
What is the canonical SMILES of D-Propargylglycine?
The canonical SMILES of D-Propargylglycine is C#CCC(C(=O)O)N.
What is the molecular weight of D-Propargylglycine according to PubChem?
The molecular weight of D-Propargylglycine according to PubChem is 113.11 g/mol.
What is the CAS number of D-Propargylglycine?
The CAS number of D-Propargylglycine is 23235-03-2.
What is the ChEMBL ID of D-Propargylglycine?
The ChEMBL ID of D-Propargylglycine is CHEMBL51369.
What is the topological polar surface area of D-Propargylglycine?
The topological polar surface area of D-Propargylglycine is 63.3Ų.