What is the molecular formula of D-beta-homoserine?
The molecular formula of D-beta-homoserine is C4H9NO3.
What is the molecular weight of D-beta-homoserine?
The molecular weight of D-beta-homoserine is 119.12 g/mol.
What is the IUPAC name of D-beta-homoserine?
The IUPAC name of D-beta-homoserine is (3S)-3-amino-4-hydroxybutanoic acid.
What is the InChI of D-beta-homoserine?
The InChI of D-beta-homoserine is InChI=1S/C4H9NO3/c5-3(2-6)1-4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1.
What is the InChIKey of D-beta-homoserine?
The InChIKey of D-beta-homoserine is BUZICZZQJDLXJN-VKHMYHEASA-N.
What is the canonical SMILES of D-beta-homoserine?
The canonical SMILES of D-beta-homoserine is C(C(CO)N)C(=O)O.
What is the CAS number of D-beta-homoserine?
The CAS number of D-beta-homoserine is 16504-57-7.
What is the XLogP3-AA value of D-beta-homoserine?
The XLogP3-AA value of D-beta-homoserine is -4.1.
How many hydrogen bond donor counts does D-beta-homoserine have?
D-beta-homoserine has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does D-beta-homoserine have?
D-beta-homoserine has 4 hydrogen bond acceptor counts.