What is the molecular formula of D-Allo-threoninol?
The molecular formula is C4H11NO2.
What is the molecular weight of D-Allo-threoninol?
The molecular weight is 105.14 g/mol.
When was D-Allo-threoninol created?
D-Allo-threoninol was created on July 13, 2005.
What is the IUPAC name of D-Allo-threoninol?
The IUPAC name is (2S,3R)-2-aminobutane-1,3-diol.
What is the InChI of D-Allo-threoninol?
The InChI is InChI=1S/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4+/m1/s1.
What is the InChIKey of D-Allo-threoninol?
The InChIKey is MUVQIIBPDFTEKM-DMTCNVIQSA-N.
What is the Canonical SMILES of D-Allo-threoninol?
The Canonical SMILES is CC(C(CO)N)O.
What is the Isomeric SMILES of D-Allo-threoninol?
The Isomeric SMILES is C[C@H]([C@H](CO)N)O.
What is the CAS number of D-Allo-threoninol?
The CAS number is 44520-54-9.
Is D-Allo-threoninol considered as a Covalently-Bonded Unit?
Yes, D-Allo-threoninol is considered as a Covalently-Bonded Unit.