What is the molecular formula of D-Alanine benzyl ester?
The molecular formula of D-Alanine benzyl ester is C10H13NO2.
What is the molecular weight of D-Alanine benzyl ester?
The molecular weight of D-Alanine benzyl ester is 179.22 g/mol.
When was D-Alanine benzyl ester created?
D-Alanine benzyl ester was created on July 8, 2005.
What is the IUPAC name of D-Alanine benzyl ester?
The IUPAC name of D-Alanine benzyl ester is benzyl (2R)-2-aminopropanoate.
What is the InChI of D-Alanine benzyl ester?
The InChI of D-Alanine benzyl ester is InChI=1S/C10H13NO2/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8H,7,11H2,1H3/t8-/m1/s1.
What is the InChIKey of D-Alanine benzyl ester?
The InChIKey of D-Alanine benzyl ester is YGYLYUIRSJSFJS-MRVPVSSYSA-N.
How many hydrogen bond donor counts does D-Alanine benzyl ester have?
D-Alanine benzyl ester has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does D-Alanine benzyl ester have?
D-Alanine benzyl ester has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of D-Alanine benzyl ester?
The topological polar surface area of D-Alanine benzyl ester is 52.3Ų.
Is D-Alanine benzyl ester the canonical form?
Yes, D-Alanine benzyl ester is the canonical form.