What is the molecular formula of D-4-tert-Butyl-phe?
The molecular formula of D-4-tert-Butyl-phe is C13H19NO2.
What is the molecular weight of D-4-tert-Butyl-phe?
The molecular weight of D-4-tert-Butyl-phe is 221.29 g/mol.
What is the IUPAC name of D-4-tert-Butyl-phe?
The IUPAC name of D-4-tert-Butyl-phe is (2R)-2-amino-3-(4-tert-butylphenyl)propanoic acid.
What is the InChI of D-4-tert-Butyl-phe?
The InChI of D-4-tert-Butyl-phe is InChI=1S/C13H19NO2/c1-13(2,3)10-6-4-9(5-7-10)8-11(14)12(15)16/h4-7,11H,8,14H2,1-3H3,(H,15,16)/t11-/m1/s1.
What is the InChIKey of D-4-tert-Butyl-phe?
The InChIKey of D-4-tert-Butyl-phe is CSJZKSXYLTYFPU-LLVKDONJSA-N.
What is the canonical SMILES of D-4-tert-Butyl-phe?
The canonical SMILES of D-4-tert-Butyl-phe is CC(C)(C)C1=CC=C(C=C1)CC(C(=O)O)N.
What is the isomeric SMILES of D-4-tert-Butyl-phe?
The isomeric SMILES of D-4-tert-Butyl-phe is CC(C)(C)C1=CC=C(C=C1)C[C@H](C(=O)O)N.
What is the CAS number of D-4-tert-Butyl-phe?
The CAS number of D-4-tert-Butyl-phe is 274262-82-7.
What is the XLogP3 value of D-4-tert-Butyl-phe?
The XLogP3 value of D-4-tert-Butyl-phe is 0.2.
Is D-4-tert-Butyl-phe a canonicalized compound?
Yes, D-4-tert-Butyl-phe is a canonicalized compound.